C15H20N2O4 — CID 81095131
[2-(cyclopentylamino)-2-oxoethyl] 3-amino-5-methoxybenzoate (PubChem CID 81095131) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 3-amino-5-methoxybenzoate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 3-amino-5-methoxybenzoate |
|---|---|
| PubChem CID | 81095131 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 3-amino-5-methoxybenzoate |
| SMILES | COc1cc(N)cc(C(=O)OCC(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-13-7-10(6-11(16)8-13)15(19)21-9-14(18)17-12-4-2-3-5-12/h6-8,12H,2-5,9,16H2,1H3,(H,17,18) |
| InChIKey | ICEUKZFYQFPBMB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|