C14H18N2O4 — CID 81092520
[2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-5-methoxybenzoate (PubChem CID 81092520) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-5-methoxybenzoate.
| Compound Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-5-methoxybenzoate |
|---|---|
| PubChem CID | 81092520 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-[cyclopropyl(methyl)amino]-2-oxoethyl] 3-amino-5-methoxybenzoate |
| SMILES | COc1cc(N)cc(C(=O)OCC(=O)N(C)C2CC2)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-16(11-3-4-11)13(17)8-20-14(18)9-5-10(15)7-12(6-9)19-2/h5-7,11H,3-4,8,15H2,1-2H3 |
| InChIKey | QYICWNCUSVCNDC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|