C13H19N3O4 — CID 81096018
5-[[[2-hydroxyethyl(propyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid (PubChem CID 81096018) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 5-[[[2-hydroxyethyl(propyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[[2-hydroxyethyl(propyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81096018 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 5-[[[2-hydroxyethyl(propyl)carbamoyl]amino]methyl]pyridine-2-carboxylic acid |
| SMILES | CCCN(CCO)C(=O)NCc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C13H19N3O4/c1-2-5-16(6-7-17)13(20)15-9-10-3-4-11(12(18)19)14-8-10/h3-4,8,17H,2,5-7,9H2,1H3,(H,15,20)(H,18,19) |
| InChIKey | LFPLRJWDVUJDMG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |