C11H14N4O4 — CID 81096531
5-[[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]methyl]pyridine-2-carboxylic acid (PubChem CID 81096531) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is 5-[[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81096531 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-[[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]methyl]pyridine-2-carboxylic acid |
| SMILES | CN(CC(N)=O)C(=O)NCc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C11H14N4O4/c1-15(6-9(12)16)11(19)14-5-7-2-3-8(10(17)18)13-4-7/h2-4H,5-6H2,1H3,(H2,12,16)(H,14,19)(H,17,18) |
| InChIKey | SKOFOVZVYONNGC-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 125.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |