C14H20FNO2 — CID 81097570
1-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-4-methylpiperidin-4-ol (PubChem CID 81097570) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 81097570 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1-[4-fluoro-2-[(1S)-1-hydroxyethyl]phenyl]-4-methylpiperidin-4-ol |
| SMILES | C[C@H](O)c1cc(F)ccc1N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C14H20FNO2/c1-10(17)12-9-11(15)3-4-13(12)16-7-5-14(2,18)6-8-16/h3-4,9-10,17-18H,5-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | LYILHXJKFUMXFT-JTQLQIEISA-N |
| XLogP | 2.23 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |