C14H20FNO — CID 55161928
1-[2-(2,2-dimethylpyrrolidin-1-yl)-5-fluorophenyl]ethanol (PubChem CID 55161928) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpyrrolidin-1-yl)-5-fluorophenyl]ethanol.
| Compound Name | 1-[2-(2,2-dimethylpyrrolidin-1-yl)-5-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 55161928 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[2-(2,2-dimethylpyrrolidin-1-yl)-5-fluorophenyl]ethanol |
| SMILES | CC(O)c1cc(F)ccc1N1CCCC1(C)C |
| InChI | InChI=1S/C14H20FNO/c1-10(17)12-9-11(15)5-6-13(12)16-8-4-7-14(16,2)3/h5-6,9-10,17H,4,7-8H2,1-3H3 |
| InChIKey | WDBHJKUETYVBCV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |