C14H20ClNO — CID 78941205
(1R)-1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]ethanol (PubChem CID 78941205) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (1R)-1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 78941205 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (1R)-1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(N2CCCC2(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClNO/c1-10(17)11-5-6-13(12(15)9-11)16-8-4-7-14(16,2)3/h5-6,9-10,17H,4,7-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | XUHRTGVJJJNQFQ-SNVBAGLBSA-N |
| XLogP | 3.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|