About 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine
1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine (PubChem CID 81166004) has the molecular formula C15H23ClN2
and a molecular weight of 266.82 g/mol. Its IUPAC name is 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine.
Molecular Properties
| Compound Name | 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine |
| PubChem CID | 81166004 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(N2CCCC2(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2/c1-11(17)9-12-5-6-14(13(16)10-12)18-8-4-7-15(18,2)3/h5-6,10-11H,4,7-9,17H2,1-3H3 |
| InChIKey | WWQAYORMUJUFQE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine?
The IUPAC name of 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine (CID 81166004) is 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine.
What is the SMILES notation for 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine?
The canonical SMILES for 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine is CC(N)Cc1ccc(N2CCCC2(C)C)c(Cl)c1.
What is the InChIKey of 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine?
The InChIKey is WWQAYORMUJUFQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2/c1-11(17)9-12-5-6-14(13(16)10-12)18-8-4-7-15(18,2)3/h5-6,10-11H,4,7-9,17H2,1-3H3.
What are the key properties of 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine?
1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine has a molecular weight of 266.82 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-chloro-4-(2,2-dimethylpyrrolidin-1-yl)phenyl]propan-2-amine is sourced from PubChem (CID 81166004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).