C12H21BrN2O2 — CID 81100436
methyl 2-bromo-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate (PubChem CID 81100436) has the molecular formula C12H21BrN2O2 and a molecular weight of 305.22 g/mol. Its IUPAC name is methyl 2-bromo-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate |
|---|---|
| PubChem CID | 81100436 |
| Molecular Formula | C12H21BrN2O2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl 2-bromo-3-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)propanoate |
| SMILES | COC(=O)C(Br)CN1CC2CCCN2CC1C |
| InChI | InChI=1S/C12H21BrN2O2/c1-9-6-14-5-3-4-10(14)7-15(9)8-11(13)12(16)17-2/h9-11H,3-8H2,1-2H3 |
| InChIKey | MFROXCMOYQSCHY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|