methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate

C11H20BrNO2 — CID 81100770

IUPACmethyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate
SMILESCOC(=O)C(Br)CN1CC(C)CCC1C
InChIInChI=1S/C11H20BrNO2/c1-8-4-5-9(2)13(6-8)7-10(12)11(14)15-3/h8-10H,4-7H2,1-3H3
InChIKeyMZCVOUJYKGXFFQ-UHFFFAOYSA-N
MW278.19 g/mol
LogP2.04
Rot. Bonds3

About methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate

methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate (PubChem CID 81100770) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate
PubChem CID81100770
Molecular FormulaC11H20BrNO2
Molecular Weight278.19 g/mol
Exact Mass277.07
IUPAC Namemethyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate
SMILESCOC(=O)C(Br)CN1CC(C)CCC1C
InChIInChI=1S/C11H20BrNO2/c1-8-4-5-9(2)13(6-8)7-10(12)11(14)15-3/h8-10H,4-7H2,1-3H3
InChIKeyMZCVOUJYKGXFFQ-UHFFFAOYSA-N
XLogP2.04
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.19
LogP ≤ 52.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate?
The IUPAC name of methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate (CID 81100770) is methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate.
What is the SMILES notation for methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate?
The canonical SMILES for methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate is COC(=O)C(Br)CN1CC(C)CCC1C.
What is the InChIKey of methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate?
The InChIKey is MZCVOUJYKGXFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20BrNO2/c1-8-4-5-9(2)13(6-8)7-10(12)11(14)15-3/h8-10H,4-7H2,1-3H3.
What are the key properties of methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate?
methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate has a molecular weight of 278.19 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate is sourced from PubChem (CID 81100770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).