C11H20BrNO2 — CID 81100770
methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate (PubChem CID 81100770) has the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. Its IUPAC name is methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate.
| Compound Name | methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate |
|---|---|
| PubChem CID | 81100770 |
| Molecular Formula | C11H20BrNO2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | methyl 2-bromo-3-(2,5-dimethylpiperidin-1-yl)propanoate |
| SMILES | COC(=O)C(Br)CN1CC(C)CCC1C |
| InChI | InChI=1S/C11H20BrNO2/c1-8-4-5-9(2)13(6-8)7-10(12)11(14)15-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | MZCVOUJYKGXFFQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|