C11H21BrN2O3 — CID 81100726
methyl 2-bromo-3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanoate (PubChem CID 81100726) has the molecular formula C11H21BrN2O3 and a molecular weight of 309.20 g/mol. Its IUPAC name is methyl 2-bromo-3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanoate.
| Compound Name | methyl 2-bromo-3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 81100726 |
| Molecular Formula | C11H21BrN2O3 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | methyl 2-bromo-3-[ethyl-[2-oxo-2-(propan-2-ylamino)ethyl]amino]propanoate |
| SMILES | CCN(CC(=O)NC(C)C)CC(Br)C(=O)OC |
| InChI | InChI=1S/C11H21BrN2O3/c1-5-14(6-9(12)11(16)17-4)7-10(15)13-8(2)3/h8-9H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | WJLOIDBWHULZEU-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|