C12H16N2O4 — CID 81101193
1-(1,3-dioxan-4-yl)-N-[(4-nitrophenyl)methyl]methanamine (PubChem CID 81101193) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-(1,3-dioxan-4-yl)-N-[(4-nitrophenyl)methyl]methanamine.
| Compound Name | 1-(1,3-dioxan-4-yl)-N-[(4-nitrophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 81101193 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-(1,3-dioxan-4-yl)-N-[(4-nitrophenyl)methyl]methanamine |
| SMILES | O=[N+]([O-])c1ccc(CNCC2CCOCO2)cc1 |
| InChI | InChI=1S/C12H16N2O4/c15-14(16)11-3-1-10(2-4-11)7-13-8-12-5-6-17-9-18-12/h1-4,12-13H,5-9H2 |
| InChIKey | JYEJYDMZUHCEMJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|