C16H23BrN2O — CID 81104070
2-[2-(aminomethyl)-5-bromophenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81104070) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-5-bromophenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[2-(aminomethyl)-5-bromophenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81104070 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 2-[2-(aminomethyl)-5-bromophenyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | NCc1ccc(Br)cc1N1CCC2(O)CCCCC2C1 |
| InChI | InChI=1S/C16H23BrN2O/c17-14-5-4-12(10-18)15(9-14)19-8-7-16(20)6-2-1-3-13(16)11-19/h4-5,9,13,20H,1-3,6-8,10-11,18H2 |
| InChIKey | WBVILUIIWZYJKN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |