C14H13ClFNOS — CID 81105163
[3-(chloromethyl)pyrrolidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone (PubChem CID 81105163) has the molecular formula C14H13ClFNOS and a molecular weight of 297.78 g/mol. Its IUPAC name is [3-(chloromethyl)pyrrolidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone.
| Compound Name | [3-(chloromethyl)pyrrolidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81105163 |
| Molecular Formula | C14H13ClFNOS |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | [3-(chloromethyl)pyrrolidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1cc2ccc(F)cc2s1)N1CCC(CCl)C1 |
| InChI | InChI=1S/C14H13ClFNOS/c15-7-9-3-4-17(8-9)14(18)13-5-10-1-2-11(16)6-12(10)19-13/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | BTFICPADTLQEAV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|