C15H15BrFNOS — CID 81105096
[2-(bromomethyl)piperidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone (PubChem CID 81105096) has the molecular formula C15H15BrFNOS and a molecular weight of 356.26 g/mol. Its IUPAC name is [2-(bromomethyl)piperidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone.
| Compound Name | [2-(bromomethyl)piperidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81105096 |
| Molecular Formula | C15H15BrFNOS |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | [2-(bromomethyl)piperidin-1-yl]-(6-fluoro-1-benzothiophen-2-yl)methanone |
| SMILES | O=C(c1cc2ccc(F)cc2s1)N1CCCCC1CBr |
| InChI | InChI=1S/C15H15BrFNOS/c16-9-12-3-1-2-6-18(12)15(19)14-7-10-4-5-11(17)8-13(10)20-14/h4-5,7-8,12H,1-3,6,9H2 |
| InChIKey | OHPQWMLVOJPEHM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|