C14H16BrNOS2 — CID 116639438
[2-(bromomethyl)azepan-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 116639438) has the molecular formula C14H16BrNOS2 and a molecular weight of 358.33 g/mol. Its IUPAC name is [2-(bromomethyl)azepan-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | [2-(bromomethyl)azepan-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 116639438 |
| Molecular Formula | C14H16BrNOS2 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | [2-(bromomethyl)azepan-1-yl]-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | O=C(c1cc2sccc2s1)N1CCCCCC1CBr |
| InChI | InChI=1S/C14H16BrNOS2/c15-9-10-4-2-1-3-6-16(10)14(17)13-8-12-11(19-13)5-7-18-12/h5,7-8,10H,1-4,6,9H2 |
| InChIKey | UYWUGZUAVMOMGH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|