C11H16FNS — CID 81106933
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-fluoropropan-1-amine (PubChem CID 81106933) has the molecular formula C11H16FNS and a molecular weight of 213.32 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-fluoropropan-1-amine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 81106933 |
| Molecular Formula | C11H16FNS |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-fluoropropan-1-amine |
| SMILES | FCCCNCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C11H16FNS/c12-5-2-6-13-8-10-7-9-3-1-4-11(9)14-10/h7,13H,1-6,8H2 |
| InChIKey | JATRRADGQHXDPD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|