C18H25NO2 — CID 81111205
2-(4-hydroxybut-1-ynyl)-5-methyl-N,N-dipropylbenzamide (PubChem CID 81111205) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-(4-hydroxybut-1-ynyl)-5-methyl-N,N-dipropylbenzamide.
| Compound Name | 2-(4-hydroxybut-1-ynyl)-5-methyl-N,N-dipropylbenzamide |
|---|---|
| PubChem CID | 81111205 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-(4-hydroxybut-1-ynyl)-5-methyl-N,N-dipropylbenzamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)ccc1C#CCCO |
| InChI | InChI=1S/C18H25NO2/c1-4-11-19(12-5-2)18(21)17-14-15(3)9-10-16(17)8-6-7-13-20/h9-10,14,20H,4-5,7,11-13H2,1-3H3 |
| InChIKey | ZESIOWVPUJMNSR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|