C15H16F3NO2 — CID 81112952
2-(4-hydroxybut-1-ynyl)-N,5-dimethyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 81112952) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(4-hydroxybut-1-ynyl)-N,5-dimethyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-(4-hydroxybut-1-ynyl)-N,5-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 81112952 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(4-hydroxybut-1-ynyl)-N,5-dimethyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(C#CCCO)c(C(=O)N(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO2/c1-11-6-7-12(5-3-4-8-20)13(9-11)14(21)19(2)10-15(16,17)18/h6-7,9,20H,4,8,10H2,1-2H3 |
| InChIKey | BBPLBHBLRXWKKN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|