C13H25FN2 — CID 81114428
8-ethyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane (PubChem CID 81114428) has the molecular formula C13H25FN2 and a molecular weight of 228.35 g/mol. Its IUPAC name is 8-ethyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 81114428 |
| Molecular Formula | C13H25FN2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | 8-ethyl-6-(3-fluoropropyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CN(CCCF)C2(CCCC2)CN1 |
| InChI | InChI=1S/C13H25FN2/c1-2-12-10-16(9-5-8-14)13(11-15-12)6-3-4-7-13/h12,15H,2-11H2,1H3 |
| InChIKey | WDQBXKRPSNZLPX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |