C12H21FN2O2 — CID 81114569
3-ethyl-1-(3-fluoropropyl)-6-propylpiperazine-2,5-dione (PubChem CID 81114569) has the molecular formula C12H21FN2O2 and a molecular weight of 244.31 g/mol. Its IUPAC name is 3-ethyl-1-(3-fluoropropyl)-6-propylpiperazine-2,5-dione.
| Compound Name | 3-ethyl-1-(3-fluoropropyl)-6-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 81114569 |
| Molecular Formula | C12H21FN2O2 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-ethyl-1-(3-fluoropropyl)-6-propylpiperazine-2,5-dione |
| SMILES | CCCC1C(=O)NC(CC)C(=O)N1CCCF |
| InChI | InChI=1S/C12H21FN2O2/c1-3-6-10-11(16)14-9(4-2)12(17)15(10)8-5-7-13/h9-10H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | ACJZFNWFTJXMPY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |