C14H23F3N2O2 — CID 115522571
6-ethyl-3-propyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione (PubChem CID 115522571) has the molecular formula C14H23F3N2O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 6-ethyl-3-propyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione.
| Compound Name | 6-ethyl-3-propyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 115522571 |
| Molecular Formula | C14H23F3N2O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-ethyl-3-propyl-1-(5,5,5-trifluoropentyl)piperazine-2,5-dione |
| SMILES | CCCC1NC(=O)C(CC)N(CCCCC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H23F3N2O2/c1-3-7-10-13(21)19(11(4-2)12(20)18-10)9-6-5-8-14(15,16)17/h10-11H,3-9H2,1-2H3,(H,18,20) |
| InChIKey | JYTVJYJEBKOBEJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|