C15H24N2O2 — CID 106210830
6-ethyl-1-hex-5-ynyl-3-propylpiperazine-2,5-dione (PubChem CID 106210830) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 6-ethyl-1-hex-5-ynyl-3-propylpiperazine-2,5-dione.
| Compound Name | 6-ethyl-1-hex-5-ynyl-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 106210830 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6-ethyl-1-hex-5-ynyl-3-propylpiperazine-2,5-dione |
| SMILES | C#CCCCCN1C(=O)C(CCC)NC(=O)C1CC |
| InChI | InChI=1S/C15H24N2O2/c1-4-7-8-9-11-17-13(6-3)14(18)16-12(10-5-2)15(17)19/h1,12-13H,5-11H2,2-3H3,(H,16,18) |
| InChIKey | MQSZZSOENSCNBH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|