C17H17FN2S — CID 81115596
1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-2-(5-methyl-2-pyridinyl)ethanamine (PubChem CID 81115596) has the molecular formula C17H17FN2S and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-2-(5-methyl-2-pyridinyl)ethanamine.
| Compound Name | 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-2-(5-methyl-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 81115596 |
| Molecular Formula | C17H17FN2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(6-fluoro-1-benzothiophen-2-yl)-N-methyl-2-(5-methyl-2-pyridinyl)ethanamine |
| SMILES | CNC(Cc1ccc(C)cn1)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C17H17FN2S/c1-11-3-6-14(20-10-11)9-15(19-2)17-7-12-4-5-13(18)8-16(12)21-17/h3-8,10,15,19H,9H2,1-2H3 |
| InChIKey | CVPRJEJTBYOPEU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |