C11H14F3NOS — CID 81117978
3-[[4-amino-2-(trifluoromethyl)phenyl]methylsulfanyl]propan-1-ol (PubChem CID 81117978) has the molecular formula C11H14F3NOS and a molecular weight of 265.30 g/mol. Its IUPAC name is 3-[[4-amino-2-(trifluoromethyl)phenyl]methylsulfanyl]propan-1-ol.
| Compound Name | 3-[[4-amino-2-(trifluoromethyl)phenyl]methylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 81117978 |
| Molecular Formula | C11H14F3NOS |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 3-[[4-amino-2-(trifluoromethyl)phenyl]methylsulfanyl]propan-1-ol |
| SMILES | Nc1ccc(CSCCCO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NOS/c12-11(13,14)10-6-9(15)3-2-8(10)7-17-5-1-4-16/h2-3,6,16H,1,4-5,7,15H2 |
| InChIKey | GGEANNOATDFHAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|