C13H14N2O4S2 — CID 81119223
4-methoxy-N-methyl-N-(4-sulfamoylphenyl)thiophene-2-carboxamide (PubChem CID 81119223) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-methoxy-N-methyl-N-(4-sulfamoylphenyl)thiophene-2-carboxamide.
| Compound Name | 4-methoxy-N-methyl-N-(4-sulfamoylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 81119223 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-methoxy-N-methyl-N-(4-sulfamoylphenyl)thiophene-2-carboxamide |
| SMILES | COc1csc(C(=O)N(C)c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C13H14N2O4S2/c1-15(13(16)12-7-10(19-2)8-20-12)9-3-5-11(6-4-9)21(14,17)18/h3-8H,1-2H3,(H2,14,17,18) |
| InChIKey | OJPHHXUGLUKLEL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |