C13H17BrN2O3S — CID 81120312
(3R)-1-[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]piperidine-3-carboxylic acid (PubChem CID 81120312) has the molecular formula C13H17BrN2O3S and a molecular weight of 361.26 g/mol. Its IUPAC name is (3R)-1-[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81120312 |
| Molecular Formula | C13H17BrN2O3S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | (3R)-1-[(4-bromothiophen-2-yl)methyl-methylcarbamoyl]piperidine-3-carboxylic acid |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)N1CCC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H17BrN2O3S/c1-15(7-11-5-10(14)8-20-11)13(19)16-4-2-3-9(6-16)12(17)18/h5,8-9H,2-4,6-7H2,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | IXDCNKPINLLXLT-SECBINFHSA-N |
| XLogP | 2.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |