C13H16BrNO2S — CID 115150459
N-[(4-bromothiophen-2-yl)methyl]-N-methyl-4-oxocyclohexane-1-carboxamide (PubChem CID 115150459) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-methyl-4-oxocyclohexane-1-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-4-oxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115150459 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-methyl-4-oxocyclohexane-1-carboxamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C1CCC(=O)CC1 |
| InChI | InChI=1S/C13H16BrNO2S/c1-15(7-12-6-10(14)8-18-12)13(17)9-2-4-11(16)5-3-9/h6,8-9H,2-5,7H2,1H3 |
| InChIKey | GVJVPZZANDUNTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |