C11H16BrClN2OS — CID 119731625
N-[(4-bromothiophen-2-yl)methyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119731625) has the molecular formula C11H16BrClN2OS and a molecular weight of 339.69 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119731625 |
| Molecular Formula | C11H16BrClN2OS |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N-methylpyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C1CCNC1.Cl |
| InChI | InChI=1S/C11H15BrN2OS.ClH/c1-14(6-10-4-9(12)7-16-10)11(15)8-2-3-13-5-8;/h4,7-8,13H,2-3,5-6H2,1H3;1H |
| InChIKey | LXPXVMAHTVCEEM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |