C10H10BrCl2NOS — CID 78879991
N-[(4-bromothiophen-2-yl)methyl]-2,2-dichloro-N-methylcyclopropane-1-carboxamide (PubChem CID 78879991) has the molecular formula C10H10BrCl2NOS and a molecular weight of 343.07 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2,2-dichloro-N-methylcyclopropane-1-carboxamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2,2-dichloro-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78879991 |
| Molecular Formula | C10H10BrCl2NOS |
| Molecular Weight | 343.07 g/mol |
| Exact Mass | 340.90 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2,2-dichloro-N-methylcyclopropane-1-carboxamide |
| SMILES | CN(Cc1cc(Br)cs1)C(=O)C1CC1(Cl)Cl |
| InChI | InChI=1S/C10H10BrCl2NOS/c1-14(4-7-2-6(11)5-16-7)9(15)8-3-10(8,12)13/h2,5,8H,3-4H2,1H3 |
| InChIKey | AXPTYEXGEKYPRX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.07 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|