C13H17NOS2 — CID 81127074
1-(5-ethylthiophen-2-yl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine (PubChem CID 81127074) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-ethylthiophen-2-yl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 81127074 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)-1-(3-methoxythiophen-2-yl)-N-methylmethanamine |
| SMILES | CCc1ccc(C(NC)c2sccc2OC)s1 |
| InChI | InChI=1S/C13H17NOS2/c1-4-9-5-6-11(17-9)12(14-2)13-10(15-3)7-8-16-13/h5-8,12,14H,4H2,1-3H3 |
| InChIKey | HFFRZRQPNAHGJQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |