C15H21NS2 — CID 79986033
N-[(3-ethylthiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]ethanamine (PubChem CID 79986033) has the molecular formula C15H21NS2 and a molecular weight of 279.47 g/mol. Its IUPAC name is N-[(3-ethylthiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-ethylthiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79986033 |
| Molecular Formula | C15H21NS2 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-[(3-ethylthiophen-2-yl)-(5-ethylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(CC)s1)c1sccc1CC |
| InChI | InChI=1S/C15H21NS2/c1-4-11-9-10-17-15(11)14(16-6-3)13-8-7-12(5-2)18-13/h7-10,14,16H,4-6H2,1-3H3 |
| InChIKey | ZLZVZTUHERMFLS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |