C14H18BrNS2 — CID 102827672
N-[(4-bromo-5-methylthiophen-2-yl)-(3-ethylthiophen-2-yl)methyl]ethanamine (PubChem CID 102827672) has the molecular formula C14H18BrNS2 and a molecular weight of 344.34 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)-(3-ethylthiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)-(3-ethylthiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 102827672 |
| Molecular Formula | C14H18BrNS2 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)-(3-ethylthiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Br)c(C)s1)c1sccc1CC |
| InChI | InChI=1S/C14H18BrNS2/c1-4-10-6-7-17-14(10)13(16-5-2)12-8-11(15)9(3)18-12/h6-8,13,16H,4-5H2,1-3H3 |
| InChIKey | MYGYAENMLWKWJU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |