C15H8BrF3OS — CID 81128771
(7-bromo-1-benzothiophen-3-yl)-(3,4,5-trifluorophenyl)methanol (PubChem CID 81128771) has the molecular formula C15H8BrF3OS and a molecular weight of 373.19 g/mol. Its IUPAC name is (7-bromo-1-benzothiophen-3-yl)-(3,4,5-trifluorophenyl)methanol.
| Compound Name | (7-bromo-1-benzothiophen-3-yl)-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 81128771 |
| Molecular Formula | C15H8BrF3OS |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | (7-bromo-1-benzothiophen-3-yl)-(3,4,5-trifluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(F)c(F)c1)c1csc2c(Br)cccc12 |
| InChI | InChI=1S/C15H8BrF3OS/c16-10-3-1-2-8-9(6-21-15(8)10)14(20)7-4-11(17)13(19)12(18)5-7/h1-6,14,20H |
| InChIKey | SEBCSDJUOCAJIU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|