C10H16N2O3 — CID 81130244
4-[(1,3-oxazol-5-ylmethylamino)methyl]oxan-4-ol (PubChem CID 81130244) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-[(1,3-oxazol-5-ylmethylamino)methyl]oxan-4-ol.
| Compound Name | 4-[(1,3-oxazol-5-ylmethylamino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81130244 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-[(1,3-oxazol-5-ylmethylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNCc2cnco2)CCOCC1 |
| InChI | InChI=1S/C10H16N2O3/c13-10(1-3-14-4-2-10)7-11-5-9-6-12-8-15-9/h6,8,11,13H,1-5,7H2 |
| InChIKey | CDHLCDQOLYUCTF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |