C14H27NO2 — CID 81130499
4-[[(3,4-dimethylcyclohexyl)amino]methyl]oxan-4-ol (PubChem CID 81130499) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-[[(3,4-dimethylcyclohexyl)amino]methyl]oxan-4-ol.
| Compound Name | 4-[[(3,4-dimethylcyclohexyl)amino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81130499 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-[[(3,4-dimethylcyclohexyl)amino]methyl]oxan-4-ol |
| SMILES | CC1CCC(NCC2(O)CCOCC2)CC1C |
| InChI | InChI=1S/C14H27NO2/c1-11-3-4-13(9-12(11)2)15-10-14(16)5-7-17-8-6-14/h11-13,15-16H,3-10H2,1-2H3 |
| InChIKey | XQRHAFVDGYBJQY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |