C14H25NO4 — CID 81131365
4-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]oxan-4-ol (PubChem CID 81131365) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]oxan-4-ol.
| Compound Name | 4-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 81131365 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 4-[(1,4-dioxaspiro[4.5]decan-8-ylamino)methyl]oxan-4-ol |
| SMILES | OC1(CNC2CCC3(CC2)OCCO3)CCOCC1 |
| InChI | InChI=1S/C14H25NO4/c16-13(5-7-17-8-6-13)11-15-12-1-3-14(4-2-12)18-9-10-19-14/h12,15-16H,1-11H2 |
| InChIKey | FWSWIKYMAYBGTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |