C9H15N3O4S — CID 81131168
N-[(4-hydroxyoxan-4-yl)methyl]-1H-imidazole-5-sulfonamide (PubChem CID 81131168) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 81131168 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-1H-imidazole-5-sulfonamide |
| SMILES | O=S(=O)(NCC1(O)CCOCC1)c1cnc[nH]1 |
| InChI | InChI=1S/C9H15N3O4S/c13-9(1-3-16-4-2-9)6-12-17(14,15)8-5-10-7-11-8/h5,7,12-13H,1-4,6H2,(H,10,11) |
| InChIKey | ITMNUUMABZSSIF-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |