C10H18N4O2S — CID 113295210
N-[[1-(aminomethyl)cyclopentyl]methyl]-1H-imidazole-5-sulfonamide (PubChem CID 113295210) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclopentyl]methyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[[1-(aminomethyl)cyclopentyl]methyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 113295210 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[[1-(aminomethyl)cyclopentyl]methyl]-1H-imidazole-5-sulfonamide |
| SMILES | NCC1(CNS(=O)(=O)c2cnc[nH]2)CCCC1 |
| InChI | InChI=1S/C10H18N4O2S/c11-6-10(3-1-2-4-10)7-14-17(15,16)9-5-12-8-13-9/h5,8,14H,1-4,6-7,11H2,(H,12,13) |
| InChIKey | DAJXLHGEMMHICC-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |