C12H19N3O — CID 81134213
(3S)-N-(2,5-dimethylpyrrol-1-yl)piperidine-3-carboxamide (PubChem CID 81134213) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is (3S)-N-(2,5-dimethylpyrrol-1-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,5-dimethylpyrrol-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81134213 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (3S)-N-(2,5-dimethylpyrrol-1-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C)n1NC(=O)[C@H]1CCCNC1 |
| InChI | InChI=1S/C12H19N3O/c1-9-5-6-10(2)15(9)14-12(16)11-4-3-7-13-8-11/h5-6,11,13H,3-4,7-8H2,1-2H3,(H,14,16)/t11-/m0/s1 |
| InChIKey | JPLCOIDWDBHHFY-NSHDSACASA-N |
| XLogP | 1.17 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |