C18H28O3 — CID 81134950
2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-propan-2-ylcyclohexan-1-ol (PubChem CID 81134950) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-propan-2-ylcyclohexan-1-ol.
| Compound Name | 2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-propan-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 81134950 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 2-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-4-propan-2-ylcyclohexan-1-ol |
| SMILES | COc1cccc(C(O)CC2CC(C(C)C)CCC2O)c1 |
| InChI | InChI=1S/C18H28O3/c1-12(2)13-7-8-17(19)15(9-13)11-18(20)14-5-4-6-16(10-14)21-3/h4-6,10,12-13,15,17-20H,7-9,11H2,1-3H3 |
| InChIKey | VJIIJXZXCIXFEV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |