C14H15N3O3S — CID 81146984
5-(diethoxymethyl)-3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazole (PubChem CID 81146984) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-(diethoxymethyl)-3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazole.
| Compound Name | 5-(diethoxymethyl)-3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 81146984 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-(diethoxymethyl)-3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazole |
| SMILES | CCOC(OCC)c1nc(-c2cnc3ccsc3c2)no1 |
| InChI | InChI=1S/C14H15N3O3S/c1-3-18-14(19-4-2)13-16-12(17-20-13)9-7-11-10(15-8-9)5-6-21-11/h5-8,14H,3-4H2,1-2H3 |
| InChIKey | VGSOEATYRQXCGN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|