C14H16N4OS — CID 81147334
5-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 81147334) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is 5-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 5-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 81147334 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 5-(3-thieno[3,2-b]pyridin-6-yl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | NCCCCCc1nc(-c2cnc3ccsc3c2)no1 |
| InChI | InChI=1S/C14H16N4OS/c15-6-3-1-2-4-13-17-14(18-19-13)10-8-12-11(16-9-10)5-7-20-12/h5,7-9H,1-4,6,15H2 |
| InChIKey | ALBDJCAOXKCKNE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|