C16H25ClN2O2 — CID 81147210
2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(oxolan-2-ylmethyl)aniline (PubChem CID 81147210) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(oxolan-2-ylmethyl)aniline.
| Compound Name | 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(oxolan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 81147210 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(oxolan-2-ylmethyl)aniline |
| SMILES | COCCNCc1ccc(N(C)CC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-19(12-14-4-3-8-21-14)16-6-5-13(10-15(16)17)11-18-7-9-20-2/h5-6,10,14,18H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | KHNWXMIRVOQKCI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|