C14H20ClF3N2O — CID 81144537
2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(3,3,3-trifluoropropyl)aniline (PubChem CID 81144537) has the molecular formula C14H20ClF3N2O and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(3,3,3-trifluoropropyl)aniline.
| Compound Name | 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(3,3,3-trifluoropropyl)aniline |
|---|---|
| PubChem CID | 81144537 |
| Molecular Formula | C14H20ClF3N2O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-chloro-4-[(2-methoxyethylamino)methyl]-N-methyl-N-(3,3,3-trifluoropropyl)aniline |
| SMILES | COCCNCc1ccc(N(C)CCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClF3N2O/c1-20(7-5-14(16,17)18)13-4-3-11(9-12(13)15)10-19-6-8-21-2/h3-4,9,19H,5-8,10H2,1-2H3 |
| InChIKey | DRISSHWYXMMNOD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|