2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid

C11H6N2O2S2 — CID 81147215

IUPAC2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(-c2cnc3ccsc3c2)n1
InChIInChI=1S/C11H6N2O2S2/c14-11(15)8-5-17-10(13-8)6-3-9-7(12-4-6)1-2-16-9/h1-5H,(H,14,15)
InChIKeyUAXIWJBUAQKNNQ-UHFFFAOYSA-N
MW262.31 g/mol
LogP3.12
Rot. Bonds2

About 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid

2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid (PubChem CID 81147215) has the molecular formula C11H6N2O2S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid
PubChem CID81147215
Molecular FormulaC11H6N2O2S2
Molecular Weight262.31 g/mol
Exact Mass261.99
IUPAC Name2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid
SMILESO=C(O)c1csc(-c2cnc3ccsc3c2)n1
InChIInChI=1S/C11H6N2O2S2/c14-11(15)8-5-17-10(13-8)6-3-9-7(12-4-6)1-2-16-9/h1-5H,(H,14,15)
InChIKeyUAXIWJBUAQKNNQ-UHFFFAOYSA-N
XLogP3.12
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.31
LogP ≤ 53.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid (CID 81147215) is 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid is O=C(O)c1csc(-c2cnc3ccsc3c2)n1.
What is the InChIKey of 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid?
The InChIKey is UAXIWJBUAQKNNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2S2/c14-11(15)8-5-17-10(13-8)6-3-9-7(12-4-6)1-2-16-9/h1-5H,(H,14,15).
What are the key properties of 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid?
2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid has a molecular weight of 262.31 g/mol, XLogP of 3.12, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]pyridin-6-yl-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 81147215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).