C15H23ClN2OS — CID 81149247
N-[[3-chloro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 81149247) has the molecular formula C15H23ClN2OS and a molecular weight of 314.88 g/mol. Its IUPAC name is N-[[3-chloro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 81149247 |
| Molecular Formula | C15H23ClN2OS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[[3-chloro-4-(1,4-thiazepan-4-yl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(N2CCCSCC2)c(Cl)c1 |
| InChI | InChI=1S/C15H23ClN2OS/c1-19-8-5-17-12-13-3-4-15(14(16)11-13)18-6-2-9-20-10-7-18/h3-4,11,17H,2,5-10,12H2,1H3 |
| InChIKey | HKDFVAFCGHBLCB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|