C14H21FN2OS — CID 63058750
N-[(3-fluoro-4-thiomorpholin-4-ylphenyl)methyl]-2-methoxyethanamine (PubChem CID 63058750) has the molecular formula C14H21FN2OS and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[(3-fluoro-4-thiomorpholin-4-ylphenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(3-fluoro-4-thiomorpholin-4-ylphenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63058750 |
| Molecular Formula | C14H21FN2OS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[(3-fluoro-4-thiomorpholin-4-ylphenyl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(N2CCSCC2)c(F)c1 |
| InChI | InChI=1S/C14H21FN2OS/c1-18-7-4-16-11-12-2-3-14(13(15)10-12)17-5-8-19-9-6-17/h2-3,10,16H,4-9,11H2,1H3 |
| InChIKey | UTLBWVRYNZYPPO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|