C16H22Cl2N2 — CID 81152611
1-[2-chloro-4-(chloromethyl)phenyl]-4-cyclopentylpiperazine (PubChem CID 81152611) has the molecular formula C16H22Cl2N2 and a molecular weight of 313.27 g/mol. Its IUPAC name is 1-[2-chloro-4-(chloromethyl)phenyl]-4-cyclopentylpiperazine.
| Compound Name | 1-[2-chloro-4-(chloromethyl)phenyl]-4-cyclopentylpiperazine |
|---|---|
| PubChem CID | 81152611 |
| Molecular Formula | C16H22Cl2N2 |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[2-chloro-4-(chloromethyl)phenyl]-4-cyclopentylpiperazine |
| SMILES | ClCc1ccc(N2CCN(C3CCCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C16H22Cl2N2/c17-12-13-5-6-16(15(18)11-13)20-9-7-19(8-10-20)14-3-1-2-4-14/h5-6,11,14H,1-4,7-10,12H2 |
| InChIKey | YEINNKLZYWKZLF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|