C11H13Cl2NOS — CID 81151854
4-[2-chloro-4-(chloromethyl)phenyl]-1,4-thiazinane 1-oxide (PubChem CID 81151854) has the molecular formula C11H13Cl2NOS and a molecular weight of 278.20 g/mol. Its IUPAC name is 4-[2-chloro-4-(chloromethyl)phenyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[2-chloro-4-(chloromethyl)phenyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 81151854 |
| Molecular Formula | C11H13Cl2NOS |
| Molecular Weight | 278.20 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 4-[2-chloro-4-(chloromethyl)phenyl]-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(c2ccc(CCl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H13Cl2NOS/c12-8-9-1-2-11(10(13)7-9)14-3-5-16(15)6-4-14/h1-2,7H,3-6,8H2 |
| InChIKey | LDBVIULMJLIBLZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.20 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|